Products 191484-63-6
CAS 191484-63-6 is the registry number for (2E)-4-(4-hydroxyphenyl)-2-butanone Oxime. Offered by: TRC. Available pack sizes: 1g.
4-[(3E)-3-hydroxyiminobutyl]phenol (CAS 191484-63-6) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 4-[(3E)-3-hydroxyiminobutyl]phenol. InChIKey: QSZRELCLIQMHDW-DHZHZOJOSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 4-[(3E)-3-hydroxyiminobutyl]phenol |
| InChIKey | QSZRELCLIQMHDW-DHZHZOJOSA-N |
| SMILES | C/C(=N\O)/CCC1=CC=C(C=C1)O |
Computed by PubChem (NCBI)