Products 1915012-21-3
CAS 1915012-21-3 is the registry number for PBRM1-BD2-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
(3E)-6-chloro-3-(2-ethylbutylidene)-1,2-dihydropyrrolo[1,2-a]quinazolin-5-one (CAS 1915012-21-3) is a chemical compound with the molecular formula C17H19ClN2O and a molecular weight of 302.8 g/mol. IUPAC name: (3E)-6-chloro-3-(2-ethylbutylidene)-1,2-dihydropyrrolo[1,2-a]quinazolin-5-one. InChIKey: MMHUNORYEVIGHF-ZRDIBKRKSA-N.
| Molecular formula | C17H19ClN2O |
|---|---|
| Molecular weight | 302.8 g/mol |
| IUPAC name | (3E)-6-chloro-3-(2-ethylbutylidene)-1,2-dihydropyrrolo[1,2-a]quinazolin-5-one |
| InChIKey | MMHUNORYEVIGHF-ZRDIBKRKSA-N |
| SMILES | CCC(CC)/C=C/1\CCN2C1=NC(=O)C3=C2C=CC=C3Cl |
Computed by PubChem (NCBI)