CAS 191744-13-5 appears in our catalog under these names: 6A,7,8,9-Tetrahydro-2h-[1,4]dioxino[2',3':4,5]benzo[1,2-e]pyrrolo[2,1-b][1,3]oxazin-11(3h)-one, 95%, BDP 37, CX614/ 97.43% (existing batch purity), CX 614, CX 614 98+%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: 100mg, 500mg, 10mg, 5mg, 25mg, 50mg, 200mg, 250mg.
4,7,11-trioxa-16-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9-trien-17-one (CAS 191744-13-5) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 4,7,11-trioxa-16-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9-trien-17-one. InChIKey: RQEPVMAYUINZRE-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 4,7,11-trioxa-16-azatetracyclo[8.7.0.03,8.012,16]heptadeca-1,3(8),9-trien-17-one |
| InChIKey | RQEPVMAYUINZRE-UHFFFAOYSA-N |
| SMILES | C1CC2N(C1)C(=O)C3=CC4=C(C=C3O2)OCCO4 |
Computed by PubChem (NCBI)