CAS 1924415-74-6 is the registry number for 2-Chloro-6-(3,5-dimethylphenoxy)aniline. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-chloro-6-(3,5-dimethylphenoxy)aniline (CAS 1924415-74-6) is a chemical compound with the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. IUPAC name: 2-chloro-6-(3,5-dimethylphenoxy)aniline. InChIKey: UTCWAMODOYJOBT-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO |
|---|---|
| Molecular weight | 247.72 g/mol |
| IUPAC name | 2-chloro-6-(3,5-dimethylphenoxy)aniline |
| InChIKey | UTCWAMODOYJOBT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OC2=C(C(=CC=C2)Cl)N)C |
Computed by PubChem (NCBI)