Products 19250-03-4
CAS 19250-03-4 is the registry number for 1-([1,1'-Biphenyl]-4-yl)thiourea, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(4-phenylphenyl)thiourea (CAS 19250-03-4) is a chemical compound with the molecular formula C13H12N2S and a molecular weight of 228.31 g/mol. IUPAC name: (4-phenylphenyl)thiourea. InChIKey: ZBLBLYUALCIFDA-UHFFFAOYSA-N.
| Molecular formula | C13H12N2S |
|---|---|
| Molecular weight | 228.31 g/mol |
| IUPAC name | (4-phenylphenyl)thiourea |
| InChIKey | ZBLBLYUALCIFDA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC(=S)N |
Computed by PubChem (NCBI)
Synonyms:
Xenyl thiourea, Urea, 1-(4-biphenylyl)-2-thio-, Thiourea, (1,1'-biphenyl)-4-yl-, N-(1,1'-Biphenyl)-4-ylthiourea, 3-12-00-03179 (Beilstein Handbook Reference), Thiourea, N-[1,1'-biphenyl]-4-yl-, (4-phenylphenyl)thiourea, 1-(biphenyl-4-yl)thiourea, 1-([1,1'-Biphenyl]-4-yl)thiourea, Thiourea,1'-biphenyl]-4-yl-