Products 19262-68-1
CAS 19262-68-1 is the registry number for D-threo-Methylphenidate Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 25mg.
Methyl (2R)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride (CAS 19262-68-1) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. IUPAC name: methyl (2R)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride. InChIKey: JUMYIBMBTDDLNG-OJERSXHUSA-N.
| Molecular formula | C14H20ClNO2 |
|---|---|
| Molecular weight | 269.77 g/mol |
| IUPAC name | methyl (2R)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride |
| InChIKey | JUMYIBMBTDDLNG-OJERSXHUSA-N |
| SMILES | COC(=O)[C@@H]([C@H]1CCCCN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
Dexmethylphenidate hydrochloride, Focalin, D-threo-Methylphenidate hydrochloride, dex-methylphenidate hydrochloride, Methylphenidate d-threo-form hydrochloride, AZSTARYS COMPONENT DEXMETHYLPHENIDATE HYDROCHLORIDE, Focalinxr, XR, Focalin, Hydrochloride, Dexmethylphenidate, Dexmethylphenidate Hydrochloride Extended-release