CAS 29419-95-2 appears in our catalog under these names: L-threo-Methylphenidate Hydrochloride, L-threo-Methylphenidate Hydrochloride (1.0mg/ml in Methanol). Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 1x1ml, 50mg, 25mg, 100mg.
Methyl (2S)-2-phenyl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride (CAS 29419-95-2) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. IUPAC name: methyl (2S)-2-phenyl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride. InChIKey: JUMYIBMBTDDLNG-QNTKWALQSA-N.
| Molecular formula | C14H20ClNO2 |
|---|---|
| Molecular weight | 269.77 g/mol |
| IUPAC name | methyl (2S)-2-phenyl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride |
| InChIKey | JUMYIBMBTDDLNG-QNTKWALQSA-N |
| SMILES | COC(=O)[C@H]([C@@H]1CCCCN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)