Products 29419-97-4
CAS 29419-97-4 is the registry number for L-erythro-Methylphenidate Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
Methyl (2R)-2-phenyl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride (CAS 29419-97-4) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. IUPAC name: methyl (2R)-2-phenyl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride. InChIKey: JUMYIBMBTDDLNG-JHEYCYPBSA-N.
| Molecular formula | C14H20ClNO2 |
|---|---|
| Molecular weight | 269.77 g/mol |
| IUPAC name | methyl (2R)-2-phenyl-2-[(2S)-piperidin-2-yl]acetate;hydrochloride |
| InChIKey | JUMYIBMBTDDLNG-JHEYCYPBSA-N |
| SMILES | COC(=O)[C@@H]([C@@H]1CCCCN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)
Synonyms:
L-erythro-Methylphenidate Hydrochloride, rac-erythro Methylphenidate Hydrochloride (1mg/ml in Acetonitrile), rac-erythro Methylphenidate Hydrochloride (1.0 mg/mL in Methanol), rac-erythro Methylphenidate Hydrochloride (1 mg/ml in Acetonitrile), Methyl (2R)-phenyl[(2S)-piperidin-2-yl]acetate--hydrogen chloride (1/1)