Products 23644-60-2
CAS 23644-60-2 appears in our catalog under these names: rac-erythro Methylphenidate Hydrochloride, >95% (HPLC), rac-erythro Methylphenidate Hydrochloride (1mg/ml in Acetonitrile), rac-erythro Methylphenidate Hydrochloride (1.0 mg/mL in Methanol). Offered by: TRC. Available pack sizes: 100mg, 50mg, 5x1ml.
Methyl (2S)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride (CAS 23644-60-2) is a chemical compound with the molecular formula C14H20ClNO2 and a molecular weight of 269.77 g/mol. IUPAC name: methyl (2S)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride. InChIKey: JUMYIBMBTDDLNG-KZCZEQIWSA-N.
| Molecular formula | C14H20ClNO2 |
|---|---|
| Molecular weight | 269.77 g/mol |
| IUPAC name | methyl (2S)-2-phenyl-2-[(2R)-piperidin-2-yl]acetate;hydrochloride |
| InChIKey | JUMYIBMBTDDLNG-KZCZEQIWSA-N |
| SMILES | COC(=O)[C@H]([C@H]1CCCCN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)