CAS 192821-24-2 is the registry number for (S,S)-(1-Dimethylcarbamoyl-2-methyl-butyl)-carbamic acid tert-butyl ester, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[(2S,3S)-1-(dimethylamino)-3-methyl-1-oxopentan-2-yl]carbamate (CAS 192821-24-2) is a chemical compound with the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. IUPAC name: tert-butyl N-[(2S,3S)-1-(dimethylamino)-3-methyl-1-oxopentan-2-yl]carbamate. InChIKey: MIEHGJLZGQANNB-UWVGGRQHSA-N.
| Molecular formula | C13H26N2O3 |
|---|---|
| Molecular weight | 258.36 g/mol |
| IUPAC name | tert-butyl N-[(2S,3S)-1-(dimethylamino)-3-methyl-1-oxopentan-2-yl]carbamate |
| InChIKey | MIEHGJLZGQANNB-UWVGGRQHSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)N(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)