Products 748760-80-7

CAS 748760-80-7 is the registry number for Brivaracetam Impurity 33. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

Ethyl (3R)-3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate (CAS 748760-80-7) is a chemical compound with the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. IUPAC name: ethyl (3R)-3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate. InChIKey: CKYVPSMIYLEXEJ-MNOVXSKESA-N.

Identity
Molecular formulaC13H26N2O3
Molecular weight258.36 g/mol
IUPAC nameethyl (3R)-3-[[[(2S)-1-amino-1-oxobutan-2-yl]amino]methyl]hexanoate
InChIKeyCKYVPSMIYLEXEJ-MNOVXSKESA-N
SMILESCCC[C@H](CC(=O)OCC)CN[C@@H](CC)C(=O)N

Computed by PubChem (NCBI)