Products 72080-89-8
CAS 72080-89-8 appears in our catalog under these names: S-(1-Dimethylcarbamoyl-3-methyl-butyl)-carbamic acid tert-butyl ester, 95%, N-((1S)-1-((Dimethylamino)carbonyl)-3-methylbutyl)-carbamic Acid 1,1-Dimethylethyl Ester. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 500mg.
Tert-butyl N-[(2S)-1-(dimethylamino)-4-methyl-1-oxopentan-2-yl]carbamate (CAS 72080-89-8) is a chemical compound with the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. IUPAC name: tert-butyl N-[(2S)-1-(dimethylamino)-4-methyl-1-oxopentan-2-yl]carbamate. InChIKey: HORYHZRFDKSOQP-JTQLQIEISA-N.
| Molecular formula | C13H26N2O3 |
|---|---|
| Molecular weight | 258.36 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1-(dimethylamino)-4-methyl-1-oxopentan-2-yl]carbamate |
| InChIKey | HORYHZRFDKSOQP-JTQLQIEISA-N |
| SMILES | CC(C)C[C@@H](C(=O)N(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)