Products 2134676-96-1
CAS 2134676-96-1 is the registry number for tert-Butyl (2R,6R)-4-(2-hydroxyethyl)-2,6-dimethylpiperazine-1-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R,6R)-4-(2-hydroxyethyl)-2,6-dimethylpiperazine-1-carboxylate (CAS 2134676-96-1) is a chemical compound with the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. IUPAC name: tert-butyl (2R,6R)-4-(2-hydroxyethyl)-2,6-dimethylpiperazine-1-carboxylate. InChIKey: MGWUVQZRABLPQF-GHMZBOCLSA-N.
| Molecular formula | C13H26N2O3 |
|---|---|
| Molecular weight | 258.36 g/mol |
| IUPAC name | tert-butyl (2R,6R)-4-(2-hydroxyethyl)-2,6-dimethylpiperazine-1-carboxylate |
| InChIKey | MGWUVQZRABLPQF-GHMZBOCLSA-N |
| SMILES | C[C@@H]1CN(C[C@H](N1C(=O)OC(C)(C)C)C)CCO |
Computed by PubChem (NCBI)