CAS 193002-14-1 appears in our catalog under these names: 7-(Benzyloxy)-3,4-dihydroquinazolin-4-one, 4(1H)-Quinazolinone, 7-(phenylmethoxy)-, 95%, 95%, 4(1H)-Quinazolinone, 7-(phenylmethoxy)-, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
7-phenylmethoxy-3H-quinazolin-4-one (CAS 193002-14-1) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 252.27 g/mol. IUPAC name: 7-phenylmethoxy-3H-quinazolin-4-one. InChIKey: KEMWNYKFWBNOAT-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 252.27 g/mol |
| IUPAC name | 7-phenylmethoxy-3H-quinazolin-4-one |
| InChIKey | KEMWNYKFWBNOAT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)C(=O)NC=N3 |
Computed by PubChem (NCBI)