CAS 1932023-27-2 is the registry number for N-Boc-d-allothreoninal acetonide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl N-[(4R,5S)-2,2,4-trimethyl-1,3-dioxan-5-yl]carbamate (CAS 1932023-27-2) is a chemical compound with the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. IUPAC name: tert-butyl N-[(4R,5S)-2,2,4-trimethyl-1,3-dioxan-5-yl]carbamate. InChIKey: FOGIIADEKHIPQG-BDAKNGLRSA-N.
| Molecular formula | C12H23NO4 |
|---|---|
| Molecular weight | 245.32 g/mol |
| IUPAC name | tert-butyl N-[(4R,5S)-2,2,4-trimethyl-1,3-dioxan-5-yl]carbamate |
| InChIKey | FOGIIADEKHIPQG-BDAKNGLRSA-N |
| SMILES | C[C@@H]1[C@H](COC(O1)(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)