Products 1932136-98-5
CAS 1932136-98-5 is the registry number for tert-Butyl (R)-2-formyl-4,4-dimethyloxazolidine-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl (2R)-2-formyl-4,4-dimethyl-1,3-oxazolidine-3-carboxylate (CAS 1932136-98-5) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: tert-butyl (2R)-2-formyl-4,4-dimethyl-1,3-oxazolidine-3-carboxylate. InChIKey: MOECBXBJYMGLKO-MRVPVSSYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | tert-butyl (2R)-2-formyl-4,4-dimethyl-1,3-oxazolidine-3-carboxylate |
| InChIKey | MOECBXBJYMGLKO-MRVPVSSYSA-N |
| SMILES | CC1(CO[C@@H](N1C(=O)OC(C)(C)C)C=O)C |
Computed by PubChem (NCBI)