CAS 1932374-95-2 appears in our catalog under these names: (S)-2-(4-(TERT-BUTOXYCARBONYL)PIPERAZIN-2-YL)ACETIC ACID, 95%, 95%, (S)-2-(4-(tert-Butoxycarbonyl)piperazin-2-yl)acetic acid. Offered by: Chemat, Biosynth. Available pack sizes: 100mg, 250mg, 10g, 5g.
2-[(2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid (CAS 1932374-95-2) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: 2-[(2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid. InChIKey: JTCVUIFTKFUZNA-QMMMGPOBSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 2-[(2S)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid |
| InChIKey | JTCVUIFTKFUZNA-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@H](C1)CC(=O)O |
Computed by PubChem (NCBI)