Products 1932435-09-0
CAS 1932435-09-0 appears in our catalog under these names: (R)-2-(4-(tert-Butoxycarbonyl)piperazin-2-yl)acetic acid, (R)-2-(4-(tert-Butoxycarbonyl)piperazin-2-yl)acetic acid 97%, (R)-2-(4-(tert-Butoxycarbonyl)piperazin-2-yl)acetic acid, 97%, 97%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 5g, 100mg, 250mg.
2-[(2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid (CAS 1932435-09-0) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: 2-[(2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid. InChIKey: JTCVUIFTKFUZNA-MRVPVSSYSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | 2-[(2R)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid |
| InChIKey | JTCVUIFTKFUZNA-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN[C@@H](C1)CC(=O)O |
Computed by PubChem (NCBI)