CAS 1932599-94-4 is the registry number for (R)-1,2,3,4-Tetrahydroquinoline-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-1,2,3,4-tetrahydroquinoline-4-carboxylic acid (CAS 1932599-94-4) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: (4R)-1,2,3,4-tetrahydroquinoline-4-carboxylic acid. InChIKey: LHJKXHUFXRHBBQ-MRVPVSSYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | (4R)-1,2,3,4-tetrahydroquinoline-4-carboxylic acid |
| InChIKey | LHJKXHUFXRHBBQ-MRVPVSSYSA-N |
| SMILES | C1CNC2=CC=CC=C2[C@@H]1C(=O)O |
Computed by PubChem (NCBI)