CAS 1932625-97-2 appears in our catalog under these names: (6R,7S)-7-Amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid, 95%, 7-ANCA Impurity D. Offered by: Chemat Brand. Available pack sizes: on request.
(6R,7S)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 1932625-97-2) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: (6R,7S)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: RJFPBECTFIUTHB-UJURSFKZSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | (6R,7S)-7-amino-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | RJFPBECTFIUTHB-UJURSFKZSA-N |
| SMILES | C1C=C(N2[C@H](S1)[C@H](C2=O)N)C(=O)O |
Computed by PubChem (NCBI)