CAS 1932779-15-1 appears in our catalog under these names: (1S,2S)-2-((Benzyloxy)methyl)cyclopropane-1-carboxylic acid, 95%, 95%, (1S,2S)-2-((Benzyloxy)methyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Cis-(1S,2S)-2-(phenylmethoxymethyl)cyclopropane-1-carboxylic acid (CAS 1932779-15-1) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: cis-(1S,2S)-2-(phenylmethoxymethyl)cyclopropane-1-carboxylic acid. InChIKey: FYOFPRGAVPMDRY-MNOVXSKESA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | cis-(1S,2S)-2-(phenylmethoxymethyl)cyclopropane-1-carboxylic acid |
| InChIKey | FYOFPRGAVPMDRY-MNOVXSKESA-N |
| SMILES | C1[C@@H]([C@H]1C(=O)O)COCC2=CC=CC=C2 |
Computed by PubChem (NCBI)