CAS 561055-27-4 appears in our catalog under these names: (1R,2R)-2-((Benzyloxy)Methyl)Cyclopropanecarboxylic Acid, 95%, 95%, (1R,2R)-2-((Benzyloxy)methyl)cyclopropanecarboxylic acid, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
Cis-(1R,2R)-2-(phenylmethoxymethyl)cyclopropane-1-carboxylic acid (CAS 561055-27-4) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: cis-(1R,2R)-2-(phenylmethoxymethyl)cyclopropane-1-carboxylic acid. InChIKey: FYOFPRGAVPMDRY-WDEREUQCSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | cis-(1R,2R)-2-(phenylmethoxymethyl)cyclopropane-1-carboxylic acid |
| InChIKey | FYOFPRGAVPMDRY-WDEREUQCSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)COCC2=CC=CC=C2 |
Computed by PubChem (NCBI)