Products 1932791-56-4
CAS 1932791-56-4 appears in our catalog under these names: Monomethyl auristatin E intermediate–14, Monomethyl auristatin E intermediate-14, 98.55%, Monomethyl auristatin E intermediate-14. Offered by: GLPBio, MedChemExpress, Chemat. Available pack sizes: 25mg, 50mg, 50 mg, 25 mg.
(2R,3S)-2-(benzylamino)-3-methylpentanoic acid (CAS 1932791-56-4) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 221.29 g/mol. IUPAC name: (2R,3S)-2-(benzylamino)-3-methylpentanoic acid. InChIKey: GPAVORZIWQTJJQ-CMPLNLGQSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 221.29 g/mol |
| IUPAC name | (2R,3S)-2-(benzylamino)-3-methylpentanoic acid |
| InChIKey | GPAVORZIWQTJJQ-CMPLNLGQSA-N |
| SMILES | CC[C@H](C)[C@H](C(=O)O)NCC1=CC=CC=C1 |
Computed by PubChem (NCBI)