Products 193287-70-6
CAS 193287-70-6 is the registry number for Cyclo(-Asp(OMe)-Asp(OMe)). Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg.
Methyl 2-[(2S,5S)-5-(2-methoxy-2-oxoethyl)-3,6-dioxopiperazin-2-yl]acetate (CAS 193287-70-6) is a chemical compound with the molecular formula C10H14N2O6 and a molecular weight of 258.23 g/mol. IUPAC name: methyl 2-[(2S,5S)-5-(2-methoxy-2-oxoethyl)-3,6-dioxopiperazin-2-yl]acetate. InChIKey: DZHMNVMJPZELJH-WDSKDSINSA-N.
| Molecular formula | C10H14N2O6 |
|---|---|
| Molecular weight | 258.23 g/mol |
| IUPAC name | methyl 2-[(2S,5S)-5-(2-methoxy-2-oxoethyl)-3,6-dioxopiperazin-2-yl]acetate |
| InChIKey | DZHMNVMJPZELJH-WDSKDSINSA-N |
| SMILES | COC(=O)C[C@H]1C(=O)N[C@H](C(=O)N1)CC(=O)OC |
Computed by PubChem (NCBI)