Products 1934-71-0
CAS 1934-71-0 appears in our catalog under these names: 1-Phenylcyclohexylamine Hydrochloride, >95% (HPLC), 1-Phenylcyclohexanamine hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 10mg, 1mg, 5mg, 500mg, 1000mg, 2000mg, 5000mg.
1-phenylcyclohexan-1-amine;hydrochloride (CAS 1934-71-0) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 1-phenylcyclohexan-1-amine;hydrochloride. InChIKey: AFQRMCRVQVUGMF-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 1-phenylcyclohexan-1-amine;hydrochloride |
| InChIKey | AFQRMCRVQVUGMF-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-Phenylcyclohexylamine hydrochloride, 1-phenylcyclohexanamine hydrochloride, 1-phenylcyclohexan-1-amine hydrochloride, 1-phenylcyclohexan-1-amine;hydrochloride, Benzenamine, N-cyclohexyl-, hydrochloride, Cyclohexanamine, 1-phenyl-, hydrochloride, Cyclohexylamine, 1-phenyl-, hydrochloride, 1-Fenilcicloesilammina clorhidrato [Italian], 1-Fenilcicloesilammina clorhidrato, 1-phenylcyclohexylamine, chloride