Products 1934399-85-5
CAS 1934399-85-5 is the registry number for 5,6,7,8-Tetrahydro-1,8-naphthyridine-2-carboxamide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
5,6,7,8-tetrahydro-1,8-naphthyridine-2-carboxamide (CAS 1934399-85-5) is a chemical compound with the molecular formula C9H11N3O and a molecular weight of 177.20 g/mol. IUPAC name: 5,6,7,8-tetrahydro-1,8-naphthyridine-2-carboxamide. InChIKey: SUNZCNLUYBZYMC-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-1,8-naphthyridine-2-carboxamide |
| InChIKey | SUNZCNLUYBZYMC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(NC1)N=C(C=C2)C(=O)N |
Computed by PubChem (NCBI)