Products 1934519-58-0
CAS 1934519-58-0 appears in our catalog under these names: 1-{4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl}ethanone, 95%, 1-{4,6-dimethylpyrazolo(1,5-a)pyrazin-2-yl}ethanone, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
1-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)ethanone (CAS 1934519-58-0) is a chemical compound with the molecular formula C10H11N3O and a molecular weight of 189.21 g/mol. IUPAC name: 1-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)ethanone. InChIKey: OSLUBXGIZDNGFI-UHFFFAOYSA-N.
| Molecular formula | C10H11N3O |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | 1-(4,6-dimethylpyrazolo[1,5-a]pyrazin-2-yl)ethanone |
| InChIKey | OSLUBXGIZDNGFI-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=CC(=N2)C(=O)C)C(=N1)C |
Computed by PubChem (NCBI)