Products 1934545-06-8
CAS 1934545-06-8 appears in our catalog under these names: 3-{[(tert-butoxy)carbonyl]amino}thietane-3-carboxylic acid, 95%, 95%, 3-(tert-Butoxycarbonylamino)thietane-3-carboxylic acid, 95%, 3-{[(tert-butoxy)carbonyl]amino}thietane-3-carboxylic acid, 97%. Offered by: Chemat, Ambeed, BLDpharm. Available pack sizes: 50mg, 100mg, 250mg, 1g, 500mg, 5g.
3-[(2-methylpropan-2-yl)oxycarbonylamino]thietane-3-carboxylic acid (CAS 1934545-06-8) is a chemical compound with the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]thietane-3-carboxylic acid. InChIKey: FOYHWFTWLXXFFE-UHFFFAOYSA-N.
| Molecular formula | C9H15NO4S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]thietane-3-carboxylic acid |
| InChIKey | FOYHWFTWLXXFFE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CSC1)C(=O)O |
Computed by PubChem (NCBI)