Products 1934662-24-4
CAS 1934662-24-4 is the registry number for 3-Chloro-5,6,7,8-tetrahydrocinnoline-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-chloro-5,6,7,8-tetrahydrocinnoline-6-carboxylic acid (CAS 1934662-24-4) is a chemical compound with the molecular formula C9H9ClN2O2 and a molecular weight of 212.63 g/mol. IUPAC name: 3-chloro-5,6,7,8-tetrahydrocinnoline-6-carboxylic acid. InChIKey: OXAORJYAGTVYSW-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O2 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 3-chloro-5,6,7,8-tetrahydrocinnoline-6-carboxylic acid |
| InChIKey | OXAORJYAGTVYSW-UHFFFAOYSA-N |
| SMILES | C1CC2=NN=C(C=C2CC1C(=O)O)Cl |
Computed by PubChem (NCBI)