Products 1935064-61-1
CAS 1935064-61-1 is the registry number for Benzyl 6-oxo-5-oxa-2,7-diazaspiro[3.4]octane-2-carboxylate, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 50mg, 100mg, 1g.
Benzyl 6-oxo-5-oxa-2,7-diazaspiro[3.4]octane-2-carboxylate (CAS 1935064-61-1) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. IUPAC name: benzyl 6-oxo-5-oxa-2,7-diazaspiro[3.4]octane-2-carboxylate. InChIKey: AJDOYHCMXUUJQH-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O4 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | benzyl 6-oxo-5-oxa-2,7-diazaspiro[3.4]octane-2-carboxylate |
| InChIKey | AJDOYHCMXUUJQH-UHFFFAOYSA-N |
| SMILES | C1C2(CN(C2)C(=O)OCC3=CC=CC=C3)OC(=O)N1 |
Computed by PubChem (NCBI)