Products 1935120-59-4

CAS 1935120-59-4 is the registry number for 2,5,6,7-Tetrahydro-pyrazolo[4,3-b]pyridine-4-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate (CAS 1935120-59-4) is a chemical compound with the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. IUPAC name: benzyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate. InChIKey: PWYQAPVHBNRXKE-UHFFFAOYSA-N.

Identity
Molecular formulaC14H15N3O2
Molecular weight257.29 g/mol
IUPAC namebenzyl 1,5,6,7-tetrahydropyrazolo[4,5-b]pyridine-4-carboxylate
InChIKeyPWYQAPVHBNRXKE-UHFFFAOYSA-N
SMILESC1CC2=C(C=NN2)N(C1)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)