CAS 1935367-68-2 appears in our catalog under these names: 5-Bromo-6-ethoxy-2,3-dihydroinden-1-one, 95%, 5-Bromo-6-ethoxy-2,3-dihydro-1h-inden-1-one, 98%, 1H-Inden-1-one, 5-bromo-6-ethoxy-2,3-dihydro-, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
5-bromo-6-ethoxy-2,3-dihydroinden-1-one (CAS 1935367-68-2) is a chemical compound with the molecular formula C11H11BrO2 and a molecular weight of 255.11 g/mol. IUPAC name: 5-bromo-6-ethoxy-2,3-dihydroinden-1-one. InChIKey: YGBSZWCHNXGZKQ-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO2 |
|---|---|
| Molecular weight | 255.11 g/mol |
| IUPAC name | 5-bromo-6-ethoxy-2,3-dihydroinden-1-one |
| InChIKey | YGBSZWCHNXGZKQ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2CCC(=O)C2=C1)Br |
Computed by PubChem (NCBI)