Products 1935475-64-1

CAS 1935475-64-1 is the registry number for 3-(3-Bromo-2,6-difluorophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(3-bromo-2,6-difluorophenyl)-2-oxopropanoic acid (CAS 1935475-64-1) is a chemical compound with the molecular formula C9H5BrF2O3 and a molecular weight of 279.03 g/mol. IUPAC name: 3-(3-bromo-2,6-difluorophenyl)-2-oxopropanoic acid. InChIKey: VSXJDWFWEQJAOA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5BrF2O3
Molecular weight279.03 g/mol
IUPAC name3-(3-bromo-2,6-difluorophenyl)-2-oxopropanoic acid
InChIKeyVSXJDWFWEQJAOA-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)CC(=O)C(=O)O)F)Br

Computed by PubChem (NCBI)