Products 2228879-46-5

CAS 2228879-46-5 is the registry number for 3-(2-Bromo-4,5-difluorophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2-bromo-4,5-difluorophenyl)-2-oxopropanoic acid (CAS 2228879-46-5) is a chemical compound with the molecular formula C9H5BrF2O3 and a molecular weight of 279.03 g/mol. IUPAC name: 3-(2-bromo-4,5-difluorophenyl)-2-oxopropanoic acid. InChIKey: CMFJIJXMULWIJM-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5BrF2O3
Molecular weight279.03 g/mol
IUPAC name3-(2-bromo-4,5-difluorophenyl)-2-oxopropanoic acid
InChIKeyCMFJIJXMULWIJM-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1F)F)Br)CC(=O)C(=O)O

Computed by PubChem (NCBI)