Products 2666334-37-6

CAS 2666334-37-6 is the registry number for 3-(6-Bromo-2,3-difluorophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(6-bromo-2,3-difluorophenyl)-2-oxopropanoic acid (CAS 2666334-37-6) is a chemical compound with the molecular formula C9H5BrF2O3 and a molecular weight of 279.03 g/mol. IUPAC name: 3-(6-bromo-2,3-difluorophenyl)-2-oxopropanoic acid. InChIKey: KZRKCVMKLVYKFA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H5BrF2O3
Molecular weight279.03 g/mol
IUPAC name3-(6-bromo-2,3-difluorophenyl)-2-oxopropanoic acid
InChIKeyKZRKCVMKLVYKFA-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1F)F)CC(=O)C(=O)O)Br

Computed by PubChem (NCBI)