CAS 2228882-36-6 is the registry number for 3-(4-Bromo-2,6-difluorophenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromo-2,6-difluorophenyl)-2-oxopropanoic acid (CAS 2228882-36-6) is a chemical compound with the molecular formula C9H5BrF2O3 and a molecular weight of 279.03 g/mol. IUPAC name: 3-(4-bromo-2,6-difluorophenyl)-2-oxopropanoic acid. InChIKey: NOMVPTGNXUQEAZ-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF2O3 |
|---|---|
| Molecular weight | 279.03 g/mol |
| IUPAC name | 3-(4-bromo-2,6-difluorophenyl)-2-oxopropanoic acid |
| InChIKey | NOMVPTGNXUQEAZ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)CC(=O)C(=O)O)F)Br |
Computed by PubChem (NCBI)