Products 1935491-81-8
CAS 1935491-81-8 is the registry number for 6-Bromo-7-fluoro-2,3-dihydroquinolin-4(1H)-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
6-bromo-7-fluoro-2,3-dihydro-1H-quinolin-4-one (CAS 1935491-81-8) is a chemical compound with the molecular formula C9H7BrFNO and a molecular weight of 244.06 g/mol. IUPAC name: 6-bromo-7-fluoro-2,3-dihydro-1H-quinolin-4-one. InChIKey: NMYGIZFNPUDDTQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrFNO |
|---|---|
| Molecular weight | 244.06 g/mol |
| IUPAC name | 6-bromo-7-fluoro-2,3-dihydro-1H-quinolin-4-one |
| InChIKey | NMYGIZFNPUDDTQ-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC(=C(C=C2C1=O)Br)F |
Computed by PubChem (NCBI)