CAS 193552-54-4 is the registry number for Isovanillin Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
(2E)-6-hydroxy-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-4-methoxy-5-methyl-1-benzofuran-3-one (CAS 193552-54-4) is a chemical compound with the molecular formula C18H16O6 and a molecular weight of 328.3 g/mol. IUPAC name: (2E)-6-hydroxy-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-4-methoxy-5-methyl-1-benzofuran-3-one. InChIKey: IEOVAYFLORPJRQ-VIZOYTHASA-N.
| Molecular formula | C18H16O6 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | (2E)-6-hydroxy-2-[(3-hydroxy-4-methoxyphenyl)methylidene]-4-methoxy-5-methyl-1-benzofuran-3-one |
| InChIKey | IEOVAYFLORPJRQ-VIZOYTHASA-N |
| SMILES | CC1=C(C2=C(C=C1O)O/C(=C/C3=CC(=C(C=C3)OC)O)/C2=O)OC |
Computed by PubChem (NCBI)