Products 197447-26-0
CAS 197447-26-0 appears in our catalog under these names: Isocudraniaxanthone A, Isocudraniaxanthone A. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 50mg, 25mg, 1 mg.
1,3,5,6-tetrahydroxy-4-(2-methylbut-3-en-2-yl)xanthen-9-one (CAS 197447-26-0) is a chemical compound with the molecular formula C18H16O6 and a molecular weight of 328.3 g/mol. IUPAC name: 1,3,5,6-tetrahydroxy-4-(2-methylbut-3-en-2-yl)xanthen-9-one. InChIKey: GXZSMOZDSUSQHH-UHFFFAOYSA-N.
| Molecular formula | C18H16O6 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 1,3,5,6-tetrahydroxy-4-(2-methylbut-3-en-2-yl)xanthen-9-one |
| InChIKey | GXZSMOZDSUSQHH-UHFFFAOYSA-N |
| SMILES | CC(C)(C=C)C1=C(C=C(C2=C1OC3=C(C2=O)C=CC(=C3O)O)O)O |
Computed by PubChem (NCBI)