CAS 63229-37-8 is the registry number for 1,4,5,8-Tetramethoxyanthracene-9,10-dione, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4,5,8-tetramethoxyanthracene-9,10-dione (CAS 63229-37-8) is a chemical compound with the molecular formula C18H16O6 and a molecular weight of 328.3 g/mol. IUPAC name: 1,4,5,8-tetramethoxyanthracene-9,10-dione. InChIKey: ZCRXXBBYNKRCGS-UHFFFAOYSA-N.
| Molecular formula | C18H16O6 |
|---|---|
| Molecular weight | 328.3 g/mol |
| IUPAC name | 1,4,5,8-tetramethoxyanthracene-9,10-dione |
| InChIKey | ZCRXXBBYNKRCGS-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C=C1)OC)C(=O)C3=C(C=CC(=C3C2=O)OC)OC |
Computed by PubChem (NCBI)