Products 1935565-30-2
CAS 1935565-30-2 is the registry number for Benzyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Benzyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate (CAS 1935565-30-2) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: benzyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate. InChIKey: ZDJYKQVYJQGJLK-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | benzyl 2-oxo-1,6-diazaspiro[3.3]heptane-6-carboxylate |
| InChIKey | ZDJYKQVYJQGJLK-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC12CN(C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)