Products 1936154-82-3
CAS 1936154-82-3 is the registry number for 6-Benzyl-2-thia-6-azaspiro[3.3]heptane 2,2-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-benzyl-2lambda6-thia-6-azaspiro[3.3]heptane 2,2-dioxide (CAS 1936154-82-3) is a chemical compound with the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. IUPAC name: 6-benzyl-2lambda6-thia-6-azaspiro[3.3]heptane 2,2-dioxide. InChIKey: XQPGXHYCJQENTP-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2S |
|---|---|
| Molecular weight | 237.32 g/mol |
| IUPAC name | 6-benzyl-2lambda6-thia-6-azaspiro[3.3]heptane 2,2-dioxide |
| InChIKey | XQPGXHYCJQENTP-UHFFFAOYSA-N |
| SMILES | C1C2(CN1CC3=CC=CC=C3)CS(=O)(=O)C2 |
Computed by PubChem (NCBI)