CAS 58379-82-1 is the registry number for 1-N-Propyl-1-tosylmethyl isocyanide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(1-isocyanobutylsulfonyl)-4-methylbenzene (CAS 58379-82-1) is a chemical compound with the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. IUPAC name: 1-(1-isocyanobutylsulfonyl)-4-methylbenzene. InChIKey: KAEDHYMVPXWAGH-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2S |
|---|---|
| Molecular weight | 237.32 g/mol |
| IUPAC name | 1-(1-isocyanobutylsulfonyl)-4-methylbenzene |
| InChIKey | KAEDHYMVPXWAGH-UHFFFAOYSA-N |
| SMILES | CCCC([N+]#[C-])S(=O)(=O)C1=CC=C(C=C1)C |
Computed by PubChem (NCBI)