Products 2306264-63-9
CAS 2306264-63-9 is the registry number for 6-Phenyl-5-thia-4-azaspiro[2.5]octane 5,5-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-phenyl-5lambda6-thia-4-azaspiro[2.5]octane 5,5-dioxide (CAS 2306264-63-9) is a chemical compound with the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. IUPAC name: 6-phenyl-5lambda6-thia-4-azaspiro[2.5]octane 5,5-dioxide. InChIKey: RCPSXSWECOGTHX-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2S |
|---|---|
| Molecular weight | 237.32 g/mol |
| IUPAC name | 6-phenyl-5lambda6-thia-4-azaspiro[2.5]octane 5,5-dioxide |
| InChIKey | RCPSXSWECOGTHX-UHFFFAOYSA-N |
| SMILES | C1CC2(CC2)NS(=O)(=O)C1C3=CC=CC=C3 |
Computed by PubChem (NCBI)