Products 65469-04-7

CAS 65469-04-7 is the registry number for 2-(2-Phenylethyl)-1,3-thiazolidine-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 100mg, 10g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid (CAS 65469-04-7) is a chemical compound with the molecular formula C12H15NO2S and a molecular weight of 237.32 g/mol. IUPAC name: 2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: OFMACPNNROAUSV-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO2S
Molecular weight237.32 g/mol
IUPAC name2-(2-phenylethyl)-1,3-thiazolidine-4-carboxylic acid
InChIKeyOFMACPNNROAUSV-UHFFFAOYSA-N
SMILESC1C(NC(S1)CCC2=CC=CC=C2)C(=O)O

Computed by PubChem (NCBI)