Products 1936199-87-9
CAS 1936199-87-9 appears in our catalog under these names: 6-chloro-2,3-dihydro-4H-pyrano[3,2-b]pyridin-4-one, 95%, 95%, 6-CHLORO-2,3-DIHYDRO-4H-PYRANO[3,2-B]PYRIDIN-4-ONE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 500mg, 100mg, 250mg, 1g.
6-chloro-2,3-dihydropyrano[3,2-b]pyridin-4-one (CAS 1936199-87-9) is a chemical compound with the molecular formula C8H6ClNO2 and a molecular weight of 183.59 g/mol. IUPAC name: 6-chloro-2,3-dihydropyrano[3,2-b]pyridin-4-one. InChIKey: CWIVNVJBMZIKRH-UHFFFAOYSA-N.
| Molecular formula | C8H6ClNO2 |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 6-chloro-2,3-dihydropyrano[3,2-b]pyridin-4-one |
| InChIKey | CWIVNVJBMZIKRH-UHFFFAOYSA-N |
| SMILES | C1COC2=C(C1=O)N=C(C=C2)Cl |
Computed by PubChem (NCBI)