Products 1936566-69-6
CAS 1936566-69-6 is the registry number for (5-Bromo-1,3-thiazol-4-yl)methanesulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5-bromo-1,3-thiazol-4-yl)methanesulfonyl chloride (CAS 1936566-69-6) is a chemical compound with the molecular formula C4H3BrClNO2S2 and a molecular weight of 276.6 g/mol. IUPAC name: (5-bromo-1,3-thiazol-4-yl)methanesulfonyl chloride. InChIKey: NBZUXDKSBGWOKU-UHFFFAOYSA-N.
| Molecular formula | C4H3BrClNO2S2 |
|---|---|
| Molecular weight | 276.6 g/mol |
| IUPAC name | (5-bromo-1,3-thiazol-4-yl)methanesulfonyl chloride |
| InChIKey | NBZUXDKSBGWOKU-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(S1)Br)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)