CAS 1936702-96-3 appears in our catalog under these names: 1-Phenylethane-1-sulfonyl fluoride, 95%, 1-Phenylethane-1-sulfonyl fluoride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 500mg, 1000mg.
1-phenylethanesulfonyl fluoride (CAS 1936702-96-3) is a chemical compound with the molecular formula C8H9FO2S and a molecular weight of 188.22 g/mol. IUPAC name: 1-phenylethanesulfonyl fluoride. InChIKey: YUHQONKVKQCZRU-UHFFFAOYSA-N.
| Molecular formula | C8H9FO2S |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 1-phenylethanesulfonyl fluoride |
| InChIKey | YUHQONKVKQCZRU-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)