CAS 194159-18-7 appears in our catalog under these names: Ganciclovir EP Impurity B (Ganciclovir Monopropionate), Ganciclovir EP Impurity B, Ganciclovir Impurity 2(Ganciclovir EP Impurity B), Ganciclovir Mono-O-propionate, >95% (HPLC), (2RS)-2-((2-Amino-6-oxo-1,6-dihydro-9H-purin-9-yl)methoxy)-3-hydroxy-propyl Propionate (Ganciclovir Monopropionate). Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 250mg.
[2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropyl] propanoate (CAS 194159-18-7) is a chemical compound with the molecular formula C12H17N5O5 and a molecular weight of 311.29 g/mol. IUPAC name: [2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropyl] propanoate. InChIKey: WWWAJZGPKYMTAM-UHFFFAOYSA-N.
| Molecular formula | C12H17N5O5 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | [2-[(2-amino-6-oxo-1H-purin-9-yl)methoxy]-3-hydroxypropyl] propanoate |
| InChIKey | WWWAJZGPKYMTAM-UHFFFAOYSA-N |
| SMILES | CCC(=O)OCC(CO)OCN1C=NC2=C1N=C(NC2=O)N |
Computed by PubChem (NCBI)