CAS 39708-01-5 is the registry number for 6-O-Ethylguanosine. Offered by: TRC. Available pack sizes: 1g.
(2R,3R,4S,5R)-2-(2-amino-6-ethoxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (CAS 39708-01-5) is a chemical compound with the molecular formula C12H17N5O5 and a molecular weight of 311.29 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(2-amino-6-ethoxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: YZMNBCLMSGJHTI-IOSLPCCCSA-N.
| Molecular formula | C12H17N5O5 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(2-amino-6-ethoxypurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | YZMNBCLMSGJHTI-IOSLPCCCSA-N |
| SMILES | CCOC1=NC(=NC2=C1N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N |
Computed by PubChem (NCBI)